C37H67O11P — CID 156974556
[(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-(11-methyldodecanoyloxy)propyl] (10E,12Z)-9-oxooctadeca-10,12-dienoate (PubChem CID 156974556) has the molecular formula C37H67O11P and a molecular weight of 718.91 g/mol. Its IUPAC name is [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-(11-methyldodecanoyloxy)propyl] (10E,12Z)-9-oxooctadeca-10,12-dienoate.
| Compound Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-(11-methyldodecanoyloxy)propyl] (10E,12Z)-9-oxooctadeca-10,12-dienoate |
|---|---|
| PubChem CID | 156974556 |
| Molecular Formula | C37H67O11P |
| Molecular Weight | 718.91 g/mol |
| Exact Mass | 718.44 |
| IUPAC Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-(11-methyldodecanoyloxy)propyl] (10E,12Z)-9-oxooctadeca-10,12-dienoate |
| SMILES | CCCCC/C=C\C=C\C(=O)CCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@@H](O)CO)OC(=O)CCCCCCCCCC(C)C |
| InChI | InChI=1S/C37H67O11P/c1-4-5-6-7-9-14-19-24-33(39)25-20-15-12-17-21-26-36(41)45-30-35(31-47-49(43,44)46-29-34(40)28-38)48-37(42)27-22-16-11-8-10-13-18-23-32(2)3/h9,14,19,24,32,34-35,38,40H,4-8,10-13,15-18,20-23,25-31H2,1-3H3,(H,43,44)/b14-9-,24-19+/t34-,35+/m0/s1 |
| InChIKey | AKVJPDJDDDNVGR-LKMCADJBSA-N |
| XLogP | 8.09 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.91 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|