C39H69O11P — CID 156973899
[(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-(10-methyldodecanoyloxy)propyl] (5Z,8Z,11Z,13E,15R)-15-hydroxyicosa-5,8,11,13-tetraenoate (PubChem CID 156973899) has the molecular formula C39H69O11P and a molecular weight of 744.94 g/mol. Its IUPAC name is [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-(10-methyldodecanoyloxy)propyl] (5Z,8Z,11Z,13E,15R)-15-hydroxyicosa-5,8,11,13-tetraenoate.
| Compound Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-(10-methyldodecanoyloxy)propyl] (5Z,8Z,11Z,13E,15R)-15-hydroxyicosa-5,8,11,13-tetraenoate |
|---|---|
| PubChem CID | 156973899 |
| Molecular Formula | C39H69O11P |
| Molecular Weight | 744.94 g/mol |
| Exact Mass | 744.46 |
| IUPAC Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-(10-methyldodecanoyloxy)propyl] (5Z,8Z,11Z,13E,15R)-15-hydroxyicosa-5,8,11,13-tetraenoate |
| SMILES | CCCCC[C@@H](O)/C=C/C=C\C/C=C\C/C=C\CCCC(=O)OC[C@H](COP(=O)(O)OC[C@@H](O)CO)OC(=O)CCCCCCCCC(C)CC |
| InChI | InChI=1S/C39H69O11P/c1-4-6-20-26-35(41)27-22-17-12-10-8-7-9-11-13-18-23-28-38(43)47-32-37(33-49-51(45,46)48-31-36(42)30-40)50-39(44)29-24-19-15-14-16-21-25-34(3)5-2/h7-8,11-13,17,22,27,34-37,40-42H,4-6,9-10,14-16,18-21,23-26,28-33H2,1-3H3,(H,45,46)/b8-7-,13-11-,17-12-,27-22+/t34?,35-,36+,37-/m1/s1 |
| InChIKey | MGUPKKDHXPLPEZ-KKZUKILXSA-N |
| XLogP | 8.21 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.94 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|