C39H69O12P — CID 156973954
[(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-(10-methyldodecanoyloxy)propan-2-yl] (5S,6E,8Z,11Z,13E,15R)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate (PubChem CID 156973954) has the molecular formula C39H69O12P and a molecular weight of 760.94 g/mol. Its IUPAC name is [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-(10-methyldodecanoyloxy)propan-2-yl] (5S,6E,8Z,11Z,13E,15R)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate.
| Compound Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-(10-methyldodecanoyloxy)propan-2-yl] (5S,6E,8Z,11Z,13E,15R)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate |
|---|---|
| PubChem CID | 156973954 |
| Molecular Formula | C39H69O12P |
| Molecular Weight | 760.94 g/mol |
| Exact Mass | 760.45 |
| IUPAC Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-(10-methyldodecanoyloxy)propan-2-yl] (5S,6E,8Z,11Z,13E,15R)-5,15-dihydroxyicosa-6,8,11,13-tetraenoate |
| SMILES | CCCCC[C@@H](O)/C=C/C=C\C/C=C\C=C\[C@@H](O)CCCC(=O)O[C@H](COC(=O)CCCCCCCCC(C)CC)COP(=O)(O)OC[C@@H](O)CO |
| InChI | InChI=1S/C39H69O12P/c1-4-6-16-23-34(41)24-18-13-8-7-9-14-19-25-35(42)26-21-28-39(45)51-37(32-50-52(46,47)49-30-36(43)29-40)31-48-38(44)27-20-15-11-10-12-17-22-33(3)5-2/h8-9,13-14,18-19,24-25,33-37,40-43H,4-7,10-12,15-17,20-23,26-32H2,1-3H3,(H,46,47)/b13-8-,14-9-,24-18+,25-19+/t33?,34-,35-,36+,37-/m1/s1 |
| InChIKey | JLJOPUQRFUCMNT-DFBCJKIZSA-N |
| XLogP | 7.18 |
| TPSA | 189.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.94 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|