C37H69O11P — CID 156973941
[(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(Z)-11-(3-pentyloxiran-2-yl)undec-9-enoyl]oxypropan-2-yl] 10-methyldodecanoate (PubChem CID 156973941) has the molecular formula C37H69O11P and a molecular weight of 720.92 g/mol. Its IUPAC name is [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(Z)-11-(3-pentyloxiran-2-yl)undec-9-enoyl]oxypropan-2-yl] 10-methyldodecanoate.
| Compound Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(Z)-11-(3-pentyloxiran-2-yl)undec-9-enoyl]oxypropan-2-yl] 10-methyldodecanoate |
|---|---|
| PubChem CID | 156973941 |
| Molecular Formula | C37H69O11P |
| Molecular Weight | 720.92 g/mol |
| Exact Mass | 720.46 |
| IUPAC Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(Z)-11-(3-pentyloxiran-2-yl)undec-9-enoyl]oxypropan-2-yl] 10-methyldodecanoate |
| SMILES | CCCCCC1OC1C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@@H](O)CO)OC(=O)CCCCCCCCC(C)CC |
| InChI | InChI=1S/C37H69O11P/c1-4-6-17-23-34-35(48-34)24-19-14-9-7-8-10-15-20-25-36(40)44-29-33(30-46-49(42,43)45-28-32(39)27-38)47-37(41)26-21-16-12-11-13-18-22-31(3)5-2/h14,19,31-35,38-39H,4-13,15-18,20-30H2,1-3H3,(H,42,43)/b19-14-/t31?,32-,33+,34?,35?/m0/s1 |
| InChIKey | YYTUQQYDQXMWMN-VPQULCGCSA-N |
| XLogP | 8.12 |
| TPSA | 161.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.92 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|