C45H76NO11P — CID 156988077
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[11-(3,4-dimethyl-5-propylfuran-2-yl)undecanoyloxy]propyl] (5S,6S,8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoate (PubChem CID 156988077) has the molecular formula C45H76NO11P and a molecular weight of 838.07 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[11-(3,4-dimethyl-5-propylfuran-2-yl)undecanoyloxy]propyl] (5S,6S,8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[11-(3,4-dimethyl-5-propylfuran-2-yl)undecanoyloxy]propyl] (5S,6S,8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoate |
|---|---|
| PubChem CID | 156988077 |
| Molecular Formula | C45H76NO11P |
| Molecular Weight | 838.07 g/mol |
| Exact Mass | 837.52 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[11-(3,4-dimethyl-5-propylfuran-2-yl)undecanoyloxy]propyl] (5S,6S,8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C[C@H](O)[C@@H](O)CCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCCCCCCCCCc1oc(CCC)c(C)c1C |
| InChI | InChI=1S/C45H76NO11P/c1-5-7-8-9-10-11-12-13-14-17-20-23-28-40(47)41(48)29-26-32-44(49)53-35-39(36-55-58(51,52)54-34-33-46)56-45(50)31-25-22-19-16-15-18-21-24-30-43-38(4)37(3)42(57-43)27-6-2/h7-8,10-11,13-14,20,23,39-41,47-48H,5-6,9,12,15-19,21-22,24-36,46H2,1-4H3,(H,51,52)/b8-7-,11-10-,14-13-,23-20-/t39-,40+,41+/m1/s1 |
| InChIKey | VEKIFJSGIQEGCN-WAYHOWTPSA-N |
| XLogP | 9.54 |
| TPSA | 187.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.07 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|