C41H70NO10P — CID 156988404
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[9-(3,4-dimethyl-5-propylfuran-2-yl)nonanoyloxy]propan-2-yl] (9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoate (PubChem CID 156988404) has the molecular formula C41H70NO10P and a molecular weight of 767.98 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[9-(3,4-dimethyl-5-propylfuran-2-yl)nonanoyloxy]propan-2-yl] (9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[9-(3,4-dimethyl-5-propylfuran-2-yl)nonanoyloxy]propan-2-yl] (9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoate |
|---|---|
| PubChem CID | 156988404 |
| Molecular Formula | C41H70NO10P |
| Molecular Weight | 767.98 g/mol |
| Exact Mass | 767.47 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[9-(3,4-dimethyl-5-propylfuran-2-yl)nonanoyloxy]propan-2-yl] (9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoate |
| SMILES | CC/C=C/CC(O)/C=C/C=C/CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCCCc1oc(CCC)c(C)c1C)COP(=O)(O)OCCN |
| InChI | InChI=1S/C41H70NO10P/c1-5-7-19-25-36(43)26-20-15-11-9-8-10-12-18-23-29-41(45)51-37(33-50-53(46,47)49-31-30-42)32-48-40(44)28-22-17-14-13-16-21-27-39-35(4)34(3)38(52-39)24-6-2/h7,11,15,19-20,26,36-37,43H,5-6,8-10,12-14,16-18,21-25,27-33,42H2,1-4H3,(H,46,47)/b15-11+,19-7+,26-20+/t36?,37-/m1/s1 |
| InChIKey | UNKVAPUFGMLXNO-DDQHKLDFSA-N |
| XLogP | 9.23 |
| TPSA | 167.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.98 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|