C43H74NO10P — CID 156988054
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[11-(3,4-dimethyl-5-propylfuran-2-yl)undecanoyloxy]propan-2-yl] (9Z,11E)-13-oxooctadeca-9,11-dienoate (PubChem CID 156988054) has the molecular formula C43H74NO10P and a molecular weight of 796.04 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[11-(3,4-dimethyl-5-propylfuran-2-yl)undecanoyloxy]propan-2-yl] (9Z,11E)-13-oxooctadeca-9,11-dienoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[11-(3,4-dimethyl-5-propylfuran-2-yl)undecanoyloxy]propan-2-yl] (9Z,11E)-13-oxooctadeca-9,11-dienoate |
|---|---|
| PubChem CID | 156988054 |
| Molecular Formula | C43H74NO10P |
| Molecular Weight | 796.04 g/mol |
| Exact Mass | 795.51 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[11-(3,4-dimethyl-5-propylfuran-2-yl)undecanoyloxy]propan-2-yl] (9Z,11E)-13-oxooctadeca-9,11-dienoate |
| SMILES | CCCCCC(=O)/C=C/C=C\CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCCCCCc1oc(CCC)c(C)c1C)COP(=O)(O)OCCN |
| InChI | InChI=1S/C43H74NO10P/c1-5-7-21-27-38(45)28-22-17-13-9-8-10-16-20-25-31-43(47)53-39(35-52-55(48,49)51-33-32-44)34-50-42(46)30-24-19-15-12-11-14-18-23-29-41-37(4)36(3)40(54-41)26-6-2/h13,17,22,28,39H,5-12,14-16,18-21,23-27,29-35,44H2,1-4H3,(H,48,49)/b17-13-,28-22+/t39-/m1/s1 |
| InChIKey | AFWWNAQUNGVJQR-MIHZRQTRSA-N |
| XLogP | 10.44 |
| TPSA | 164.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.04 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|