C44H77NO10P+ — CID 156996301
2-[[(2R)-2-[9-(3,4-dimethyl-5-propylfuran-2-yl)nonanoyloxy]-3-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 156996301) has the molecular formula C44H77NO10P+ and a molecular weight of 811.07 g/mol. Its IUPAC name is 2-[[(2R)-2-[9-(3,4-dimethyl-5-propylfuran-2-yl)nonanoyloxy]-3-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-2-[9-(3,4-dimethyl-5-propylfuran-2-yl)nonanoyloxy]-3-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 156996301 |
| Molecular Formula | C44H77NO10P+ |
| Molecular Weight | 811.07 g/mol |
| Exact Mass | 810.53 |
| IUPAC Name | 2-[[(2R)-2-[9-(3,4-dimethyl-5-propylfuran-2-yl)nonanoyloxy]-3-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCC(=O)/C=C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCCCc1oc(CCC)c(C)c1C |
| InChI | InChI=1S/C44H76NO10P/c1-8-10-22-28-39(46)29-23-18-14-12-11-13-15-20-25-31-43(47)51-35-40(36-53-56(49,50)52-34-33-45(5,6)7)54-44(48)32-26-21-17-16-19-24-30-42-38(4)37(3)41(55-42)27-9-2/h14,18,23,29,40H,8-13,15-17,19-22,24-28,30-36H2,1-7H3/p+1/b18-14-,29-23+/t40-/m1/s1 |
| InChIKey | BADKCMVAZSKJNO-QYBFCHMTSA-O |
| XLogP | 10.41 |
| TPSA | 138.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.07 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|