C43H72NO10P — CID 156988327
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[9-(3,4-dimethyl-5-propylfuran-2-yl)nonanoyloxy]propyl] (5Z,8Z,11Z,14Z)-17-hydroxyicosa-5,8,11,14-tetraenoate (PubChem CID 156988327) has the molecular formula C43H72NO10P and a molecular weight of 794.02 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[9-(3,4-dimethyl-5-propylfuran-2-yl)nonanoyloxy]propyl] (5Z,8Z,11Z,14Z)-17-hydroxyicosa-5,8,11,14-tetraenoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[9-(3,4-dimethyl-5-propylfuran-2-yl)nonanoyloxy]propyl] (5Z,8Z,11Z,14Z)-17-hydroxyicosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 156988327 |
| Molecular Formula | C43H72NO10P |
| Molecular Weight | 794.02 g/mol |
| Exact Mass | 793.49 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[9-(3,4-dimethyl-5-propylfuran-2-yl)nonanoyloxy]propyl] (5Z,8Z,11Z,14Z)-17-hydroxyicosa-5,8,11,14-tetraenoate |
| SMILES | CCCc1oc(CCCCCCCCC(=O)O[C@H](COC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CC(O)CCC)COP(=O)(O)OCCN)c(C)c1C |
| InChI | InChI=1S/C43H72NO10P/c1-5-26-38(45)28-22-18-14-12-10-8-7-9-11-13-15-20-24-30-42(46)50-34-39(35-52-55(48,49)51-33-32-44)53-43(47)31-25-21-17-16-19-23-29-41-37(4)36(3)40(54-41)27-6-2/h7,9-10,12-13,15,18,22,38-39,45H,5-6,8,11,14,16-17,19-21,23-35,44H2,1-4H3,(H,48,49)/b9-7-,12-10-,15-13-,22-18-/t38?,39-/m1/s1 |
| InChIKey | DMDBPHATLVLJND-DBVXQZQSSA-N |
| XLogP | 9.79 |
| TPSA | 167.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.02 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|