C44H82NO9P — CID 156990495
[(2R)-3-[(Z)-octadec-11-enoyl]oxy-2-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156990495) has the molecular formula C44H82NO9P and a molecular weight of 800.11 g/mol. Its IUPAC name is [(2R)-3-[(Z)-octadec-11-enoyl]oxy-2-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-[(Z)-octadec-11-enoyl]oxy-2-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156990495 |
| Molecular Formula | C44H82NO9P |
| Molecular Weight | 800.11 g/mol |
| Exact Mass | 799.57 |
| IUPAC Name | [(2R)-3-[(Z)-octadec-11-enoyl]oxy-2-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC/C=C\CC1OC1CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCCCC/C=C\CCCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C44H82NO9P/c1-6-8-10-12-14-15-16-17-18-19-20-21-22-26-30-34-43(46)50-38-40(39-52-55(48,49)51-37-36-45(3,4)5)53-44(47)35-31-27-23-25-29-33-42-41(54-42)32-28-24-13-11-9-7-2/h15-16,24,28,40-42H,6-14,17-23,25-27,29-39H2,1-5H3/b16-15-,28-24-/t40-,41?,42?/m1/s1 |
| InChIKey | MIYAAGYPUDCAAI-DBPHRELLSA-N |
| XLogP | 10.71 |
| TPSA | 123.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.11 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|