C30H53NO9P+ — CID 156995409
2-[[(2R)-3-acetyloxy-2-[(5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 156995409) has the molecular formula C30H53NO9P+ and a molecular weight of 602.73 g/mol. Its IUPAC name is 2-[[(2R)-3-acetyloxy-2-[(5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-3-acetyloxy-2-[(5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 156995409 |
| Molecular Formula | C30H53NO9P+ |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.35 |
| IUPAC Name | 2-[[(2R)-3-acetyloxy-2-[(5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCC/C=C\C/C=C\CC(O)/C=C\C=C\CCCC(=O)O[C@H](COC(C)=O)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C30H52NO9P/c1-6-7-8-9-10-11-12-14-17-20-28(33)21-18-15-13-16-19-22-30(34)40-29(25-37-27(2)32)26-39-41(35,36)38-24-23-31(3,4)5/h10-11,13-15,17-18,21,28-29,33H,6-9,12,16,19-20,22-26H2,1-5H3/p+1/b11-10-,15-13+,17-14-,21-18-/t28?,29-/m1/s1 |
| InChIKey | KORXVEAPLCETKJ-SHDLUFRQSA-O |
| XLogP | 5.42 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|