C28H51NO9P+ — CID 156995471
2-[[(2R)-2-acetyloxy-3-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 156995471) has the molecular formula C28H51NO9P+ and a molecular weight of 576.69 g/mol. Its IUPAC name is 2-[[(2R)-2-acetyloxy-3-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-2-acetyloxy-3-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 156995471 |
| Molecular Formula | C28H51NO9P+ |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.33 |
| IUPAC Name | 2-[[(2R)-2-acetyloxy-3-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCC(=O)/C=C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(C)=O |
| InChI | InChI=1S/C28H50NO9P/c1-6-7-15-18-26(31)19-16-13-11-9-8-10-12-14-17-20-28(32)35-23-27(38-25(2)30)24-37-39(33,34)36-22-21-29(3,4)5/h11,13,16,19,27H,6-10,12,14-15,17-18,20-24H2,1-5H3/p+1/b13-11-,19-16+/t27-/m1/s1 |
| InChIKey | PTGKMCPRSASWEV-OAXXNTOGSA-O |
| XLogP | 5.29 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|