C46H80NO8P — CID 156997328
[(2R)-2-[(1E,9Z)-octadeca-1,9-dienoxy]-3-[(6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156997328) has the molecular formula C46H80NO8P and a molecular weight of 806.12 g/mol. Its IUPAC name is [(2R)-2-[(1E,9Z)-octadeca-1,9-dienoxy]-3-[(6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-2-[(1E,9Z)-octadeca-1,9-dienoxy]-3-[(6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156997328 |
| Molecular Formula | C46H80NO8P |
| Molecular Weight | 806.12 g/mol |
| Exact Mass | 805.56 |
| IUPAC Name | [(2R)-2-[(1E,9Z)-octadeca-1,9-dienoxy]-3-[(6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C=C\C(=O)CCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)O/C=C/CCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C46H80NO8P/c1-6-8-10-12-14-16-18-20-21-22-24-26-28-30-32-34-40-52-45(43-55-56(50,51)54-41-39-47(3,4)5)42-53-46(49)38-35-37-44(48)36-33-31-29-27-25-23-19-17-15-13-11-9-7-2/h15,17,20-21,23,25,29,31,33-34,36,40,45H,6-14,16,18-19,22,24,26-28,30,32,35,37-39,41-43H2,1-5H3/b17-15-,21-20-,25-23-,31-29-,36-33+,40-34+/t45-/m1/s1 |
| InChIKey | NLALJCUPBPBSFV-NXYHRCFRSA-N |
| XLogP | 11.61 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.12 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|