C44H80NO8P — CID 156997340
[(2R)-2-[(1E,9Z)-octadeca-1,9-dienoxy]-3-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156997340) has the molecular formula C44H80NO8P and a molecular weight of 782.10 g/mol. Its IUPAC name is [(2R)-2-[(1E,9Z)-octadeca-1,9-dienoxy]-3-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-2-[(1E,9Z)-octadeca-1,9-dienoxy]-3-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156997340 |
| Molecular Formula | C44H80NO8P |
| Molecular Weight | 782.10 g/mol |
| Exact Mass | 781.56 |
| IUPAC Name | [(2R)-2-[(1E,9Z)-octadeca-1,9-dienoxy]-3-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCC/C=C/O[C@H](COC(=O)CCCCCCC/C=C\C=C\C(=O)CCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C44H80NO8P/c1-6-8-10-11-12-13-14-15-16-17-18-19-23-26-29-33-38-50-43(41-53-54(48,49)52-39-37-45(3,4)5)40-51-44(47)36-32-28-25-22-20-21-24-27-31-35-42(46)34-30-9-7-2/h15-16,24,27,31,33,35,38,43H,6-14,17-23,25-26,28-30,32,34,36-37,39-41H2,1-5H3/b16-15-,27-24-,35-31+,38-33+/t43-/m1/s1 |
| InChIKey | XNYHQRCPLQJMAK-PWZISAGMSA-N |
| XLogP | 11.28 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.10 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|