C44H82NO8P — CID 156997346
[(2R)-3-[(1E,9Z)-octadeca-1,9-dienoxy]-2-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156997346) has the molecular formula C44H82NO8P and a molecular weight of 784.11 g/mol. Its IUPAC name is [(2R)-3-[(1E,9Z)-octadeca-1,9-dienoxy]-2-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-[(1E,9Z)-octadeca-1,9-dienoxy]-2-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156997346 |
| Molecular Formula | C44H82NO8P |
| Molecular Weight | 784.11 g/mol |
| Exact Mass | 783.58 |
| IUPAC Name | [(2R)-3-[(1E,9Z)-octadeca-1,9-dienoxy]-2-[8-[3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC/C=C\CC1OC1CCCCCCCC(=O)O[C@H](CO/C=C/CCCCCC/C=C\CCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C44H82NO8P/c1-6-8-10-12-14-15-16-17-18-19-20-21-22-23-28-32-37-49-39-41(40-51-54(47,48)50-38-36-45(3,4)5)52-44(46)35-31-27-24-26-30-34-43-42(53-43)33-29-25-13-11-9-7-2/h17-18,25,29,32,37,41-43H,6-16,19-24,26-28,30-31,33-36,38-40H2,1-5H3/b18-17-,29-25-,37-32+/t41-,42?,43?/m1/s1 |
| InChIKey | WHMROECVKRNQLH-SMHBLIIESA-N |
| XLogP | 11.31 |
| TPSA | 106.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.11 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|