C44H84NO8P — CID 138251806
[3-[(Z)-octadec-9-enoxy]-2-[(Z)-11-(3-pentyloxiran-2-yl)undec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 138251806) has the molecular formula C44H84NO8P and a molecular weight of 786.13 g/mol. Its IUPAC name is [3-[(Z)-octadec-9-enoxy]-2-[(Z)-11-(3-pentyloxiran-2-yl)undec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [3-[(Z)-octadec-9-enoxy]-2-[(Z)-11-(3-pentyloxiran-2-yl)undec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 138251806 |
| Molecular Formula | C44H84NO8P |
| Molecular Weight | 786.13 g/mol |
| Exact Mass | 785.59 |
| IUPAC Name | [3-[(Z)-octadec-9-enoxy]-2-[(Z)-11-(3-pentyloxiran-2-yl)undec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCC/C=C\CC1OC1CCCCC |
| InChI | InChI=1S/C44H84NO8P/c1-6-8-10-11-12-13-14-15-16-17-18-19-22-25-28-32-37-49-39-41(40-51-54(47,48)50-38-36-45(3,4)5)52-44(46)35-31-27-24-21-20-23-26-30-34-43-42(53-43)33-29-9-7-2/h15-16,26,30,41-43H,6-14,17-25,27-29,31-40H2,1-5H3/b16-15-,30-26- |
| InChIKey | RGFYUIKGUTWOJA-SVADLMEDSA-N |
| XLogP | 11.18 |
| TPSA | 106.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.13 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|