C38H67NO6 — CID 156997689
N-[(2S,3R,4E,14Z)-1,3-dihydroxyoctadeca-4,14-dien-2-yl]-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanamide (PubChem CID 156997689) has the molecular formula C38H67NO6 and a molecular weight of 633.96 g/mol. Its IUPAC name is N-[(2S,3R,4E,14Z)-1,3-dihydroxyoctadeca-4,14-dien-2-yl]-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanamide.
| Compound Name | N-[(2S,3R,4E,14Z)-1,3-dihydroxyoctadeca-4,14-dien-2-yl]-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanamide |
|---|---|
| PubChem CID | 156997689 |
| Molecular Formula | C38H67NO6 |
| Molecular Weight | 633.96 g/mol |
| Exact Mass | 633.50 |
| IUPAC Name | N-[(2S,3R,4E,14Z)-1,3-dihydroxyoctadeca-4,14-dien-2-yl]-7-[(1R,2R,5S)-5-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-3-oxocyclopentyl]heptanamide |
| SMILES | CCC/C=C\CCCCCCCC/C=C/[C@@H](O)[C@H](CO)NC(=O)CCCCCC[C@H]1[C@@H](O)CC(=O)[C@@H]1/C=C/[C@@H](O)CCCCC |
| InChI | InChI=1S/C38H67NO6/c1-3-5-7-8-9-10-11-12-13-14-15-16-21-25-35(42)34(30-40)39-38(45)26-22-18-17-20-24-32-33(37(44)29-36(32)43)28-27-31(41)23-19-6-4-2/h7-8,21,25,27-28,31-36,40-43H,3-6,9-20,22-24,26,29-30H2,1-2H3,(H,39,45)/b8-7-,25-21+,28-27+/t31-,32+,33+,34-,35+,36-/m0/s1 |
| InChIKey | SLTFAHUOESCEMO-QRYNPHSASA-N |
| XLogP | 7.26 |
| TPSA | 127.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.96 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|