C41H73N2O7P — CID 156997945
[(2S,3R,4E,8Z)-3-hydroxy-2-[[(5Z,8Z,11Z,14Z,19S)-19-hydroxyicosa-5,8,11,14-tetraenoyl]amino]hexadeca-4,8-dienyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156997945) has the molecular formula C41H73N2O7P and a molecular weight of 737.02 g/mol. Its IUPAC name is [(2S,3R,4E,8Z)-3-hydroxy-2-[[(5Z,8Z,11Z,14Z,19S)-19-hydroxyicosa-5,8,11,14-tetraenoyl]amino]hexadeca-4,8-dienyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2S,3R,4E,8Z)-3-hydroxy-2-[[(5Z,8Z,11Z,14Z,19S)-19-hydroxyicosa-5,8,11,14-tetraenoyl]amino]hexadeca-4,8-dienyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156997945 |
| Molecular Formula | C41H73N2O7P |
| Molecular Weight | 737.02 g/mol |
| Exact Mass | 736.52 |
| IUPAC Name | [(2S,3R,4E,8Z)-3-hydroxy-2-[[(5Z,8Z,11Z,14Z,19S)-19-hydroxyicosa-5,8,11,14-tetraenoyl]amino]hexadeca-4,8-dienyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCC/C=C\CC/C=C/[C@@H](O)[C@H](COP(=O)([O-])OCC[N+](C)(C)C)NC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCC[C@H](C)O |
| InChI | InChI=1S/C41H73N2O7P/c1-6-7-8-9-10-11-17-21-24-27-30-33-40(45)39(37-50-51(47,48)49-36-35-43(3,4)5)42-41(46)34-31-28-25-22-19-16-14-12-13-15-18-20-23-26-29-32-38(2)44/h13-17,20-23,25,30,33,38-40,44-45H,6-12,18-19,24,26-29,31-32,34-37H2,1-5H3,(H-,42,46,47,48)/b15-13-,16-14-,21-17-,23-20-,25-22-,33-30+/t38-,39-,40+/m0/s1 |
| InChIKey | QPQROFKUZBOHHQ-LUQBEQDFSA-N |
| XLogP | 8.41 |
| TPSA | 128.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.02 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|