C43H77N2O7P — CID 156998473
[(2S,3R,4E,14Z)-3-hydroxy-2-[[(5Z,8Z,11Z,13E,15S)-15-hydroxyicosa-5,8,11,13-tetraenoyl]amino]octadeca-4,14-dienyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156998473) has the molecular formula C43H77N2O7P and a molecular weight of 765.07 g/mol. Its IUPAC name is [(2S,3R,4E,14Z)-3-hydroxy-2-[[(5Z,8Z,11Z,13E,15S)-15-hydroxyicosa-5,8,11,13-tetraenoyl]amino]octadeca-4,14-dienyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2S,3R,4E,14Z)-3-hydroxy-2-[[(5Z,8Z,11Z,13E,15S)-15-hydroxyicosa-5,8,11,13-tetraenoyl]amino]octadeca-4,14-dienyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156998473 |
| Molecular Formula | C43H77N2O7P |
| Molecular Weight | 765.07 g/mol |
| Exact Mass | 764.55 |
| IUPAC Name | [(2S,3R,4E,14Z)-3-hydroxy-2-[[(5Z,8Z,11Z,13E,15S)-15-hydroxyicosa-5,8,11,13-tetraenoyl]amino]octadeca-4,14-dienyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCC/C=C\CCCCCCCC/C=C/[C@@H](O)[C@H](COP(=O)([O-])OCC[N+](C)(C)C)NC(=O)CCC/C=C\C/C=C\C/C=C\C=C\[C@@H](O)CCCCC |
| InChI | InChI=1S/C43H77N2O7P/c1-6-8-10-11-12-13-14-15-18-21-24-27-31-35-42(47)41(39-52-53(49,50)51-38-37-45(3,4)5)44-43(48)36-32-28-25-22-19-16-17-20-23-26-30-34-40(46)33-29-9-7-2/h10-11,16-17,22-23,25-26,30-31,34-35,40-42,46-47H,6-9,12-15,18-21,24,27-29,32-33,36-39H2,1-5H3,(H-,44,48,49,50)/b11-10-,17-16-,25-22-,26-23-,34-30+,35-31+/t40-,41-,42+/m0/s1 |
| InChIKey | JXLOKURCURUOPL-NDPPVLGBSA-N |
| XLogP | 9.19 |
| TPSA | 128.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.07 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|