C42H75N2O7P — CID 156998159
[(2S,3R,4E,8Z)-3-hydroxy-2-[[(5Z,8Z,11Z,14Z,16R)-16-hydroxyicosa-5,8,11,14-tetraenoyl]amino]heptadeca-4,8-dienyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156998159) has the molecular formula C42H75N2O7P and a molecular weight of 751.04 g/mol. Its IUPAC name is [(2S,3R,4E,8Z)-3-hydroxy-2-[[(5Z,8Z,11Z,14Z,16R)-16-hydroxyicosa-5,8,11,14-tetraenoyl]amino]heptadeca-4,8-dienyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2S,3R,4E,8Z)-3-hydroxy-2-[[(5Z,8Z,11Z,14Z,16R)-16-hydroxyicosa-5,8,11,14-tetraenoyl]amino]heptadeca-4,8-dienyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156998159 |
| Molecular Formula | C42H75N2O7P |
| Molecular Weight | 751.04 g/mol |
| Exact Mass | 750.53 |
| IUPAC Name | [(2S,3R,4E,8Z)-3-hydroxy-2-[[(5Z,8Z,11Z,14Z,16R)-16-hydroxyicosa-5,8,11,14-tetraenoyl]amino]heptadeca-4,8-dienyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCC/C=C\CC/C=C/[C@@H](O)[C@H](COP(=O)([O-])OCC[N+](C)(C)C)NC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\[C@H](O)CCCC |
| InChI | InChI=1S/C42H75N2O7P/c1-6-8-10-11-12-13-14-18-21-24-27-30-34-41(46)40(38-51-52(48,49)50-37-36-44(3,4)5)43-42(47)35-31-28-25-22-19-16-15-17-20-23-26-29-33-39(45)32-9-7-2/h15-16,18,20-23,25,29-30,33-34,39-41,45-46H,6-14,17,19,24,26-28,31-32,35-38H2,1-5H3,(H-,43,47,48,49)/b16-15-,21-18-,23-20-,25-22-,33-29-,34-30+/t39-,40+,41-/m1/s1 |
| InChIKey | WMZZTIGBKTUVTI-JMBSSVNESA-N |
| XLogP | 8.80 |
| TPSA | 128.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.04 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|