C18H29O3- — CID 157010128
(E,11E)-11-(3-pentyloxiran-2-ylidene)undec-9-enoate (PubChem CID 157010128) has the molecular formula C18H29O3- and a molecular weight of 293.43 g/mol. Its IUPAC name is (E,11E)-11-(3-pentyloxiran-2-ylidene)undec-9-enoate.
| Compound Name | (E,11E)-11-(3-pentyloxiran-2-ylidene)undec-9-enoate |
|---|---|
| PubChem CID | 157010128 |
| Molecular Formula | C18H29O3- |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | (E,11E)-11-(3-pentyloxiran-2-ylidene)undec-9-enoate |
| SMILES | CCCCCC1O/C1=C/C=C/CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H30O3/c1-2-3-10-13-16-17(21-16)14-11-8-6-4-5-7-9-12-15-18(19)20/h8,11,14,16H,2-7,9-10,12-13,15H2,1H3,(H,19,20)/p-1/b11-8+,17-14+ |
| InChIKey | ZFVKKBAQVWQQHP-LDRANXPESA-M |
| XLogP | 3.89 |
| TPSA | 52.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|