C18H27O3- — CID 21158458
(Z,11E)-11-[(3S)-3-[(E)-pent-2-enyl]oxiran-2-ylidene]undec-9-enoate (PubChem CID 21158458) has the molecular formula C18H27O3- and a molecular weight of 291.41 g/mol. Its IUPAC name is (Z,11E)-11-[(3S)-3-[(E)-pent-2-enyl]oxiran-2-ylidene]undec-9-enoate.
| Compound Name | (Z,11E)-11-[(3S)-3-[(E)-pent-2-enyl]oxiran-2-ylidene]undec-9-enoate |
|---|---|
| PubChem CID | 21158458 |
| Molecular Formula | C18H27O3- |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | (Z,11E)-11-[(3S)-3-[(E)-pent-2-enyl]oxiran-2-ylidene]undec-9-enoate |
| SMILES | CC/C=C/C[C@@H]1O/C1=C/C=C\CCCCCCCC(=O)[O-] |
| InChI | InChI=1S/C18H28O3/c1-2-3-10-13-16-17(21-16)14-11-8-6-4-5-7-9-12-15-18(19)20/h3,8,10-11,14,16H,2,4-7,9,12-13,15H2,1H3,(H,19,20)/p-1/b10-3+,11-8-,17-14+/t16-/m0/s1 |
| InChIKey | YZBZORUZOSCZRN-VXWGVEIUSA-M |
| XLogP | 3.66 |
| TPSA | 52.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|