methyl 4-bromo-2-nitro-3-(2,2,2-trifluoroethoxy)benzoate

C10H7BrF3NO5 — CID 157010640

IUPACmethyl 4-bromo-2-nitro-3-(2,2,2-trifluoroethoxy)benzoate
SMILESCOC(=O)c1ccc(Br)c(OCC(F)(F)F)c1[N+](=O)[O-]
InChIInChI=1S/C10H7BrF3NO5/c1-19-9(16)5-2-3-6(11)8(7(5)15(17)18)20-4-10(12,13)14/h2-3H,4H2,1H3
InChIKeyBMNFBZPBIGQYMF-UHFFFAOYSA-N
MW358.07 g/mol
LogP3.09
Rot. Bonds4

About methyl 4-bromo-2-nitro-3-(2,2,2-trifluoroethoxy)benzoate

methyl 4-bromo-2-nitro-3-(2,2,2-trifluoroethoxy)benzoate (PubChem CID 157010640) has the molecular formula C10H7BrF3NO5 and a molecular weight of 358.07 g/mol. Its IUPAC name is methyl 4-bromo-2-nitro-3-(2,2,2-trifluoroethoxy)benzoate.

Molecular Properties

Compound Namemethyl 4-bromo-2-nitro-3-(2,2,2-trifluoroethoxy)benzoate
PubChem CID157010640
Molecular FormulaC10H7BrF3NO5
Molecular Weight358.07 g/mol
Exact Mass356.95
IUPAC Namemethyl 4-bromo-2-nitro-3-(2,2,2-trifluoroethoxy)benzoate
SMILESCOC(=O)c1ccc(Br)c(OCC(F)(F)F)c1[N+](=O)[O-]
InChIInChI=1S/C10H7BrF3NO5/c1-19-9(16)5-2-3-6(11)8(7(5)15(17)18)20-4-10(12,13)14/h2-3H,4H2,1H3
InChIKeyBMNFBZPBIGQYMF-UHFFFAOYSA-N
XLogP3.09
TPSA78.67 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500358.07
LogP ≤ 53.09
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze methyl 4-bromo-2-nitro-3-(2,2,2-trifluoroethoxy)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-bromo-2-nitro-3-(2,2,2-trifluoroethoxy)benzoate?
The IUPAC name of methyl 4-bromo-2-nitro-3-(2,2,2-trifluoroethoxy)benzoate (CID 157010640) is methyl 4-bromo-2-nitro-3-(2,2,2-trifluoroethoxy)benzoate.
What is the SMILES notation for methyl 4-bromo-2-nitro-3-(2,2,2-trifluoroethoxy)benzoate?
The canonical SMILES for methyl 4-bromo-2-nitro-3-(2,2,2-trifluoroethoxy)benzoate is COC(=O)c1ccc(Br)c(OCC(F)(F)F)c1[N+](=O)[O-].
What is the InChIKey of methyl 4-bromo-2-nitro-3-(2,2,2-trifluoroethoxy)benzoate?
The InChIKey is BMNFBZPBIGQYMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrF3NO5/c1-19-9(16)5-2-3-6(11)8(7(5)15(17)18)20-4-10(12,13)14/h2-3H,4H2,1H3.
What are the key properties of methyl 4-bromo-2-nitro-3-(2,2,2-trifluoroethoxy)benzoate?
methyl 4-bromo-2-nitro-3-(2,2,2-trifluoroethoxy)benzoate has a molecular weight of 358.07 g/mol, XLogP of 3.09, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-bromo-2-nitro-3-(2,2,2-trifluoroethoxy)benzoate is sourced from PubChem (CID 157010640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).