C10H7BrF3NO5 — CID 157010640
methyl 4-bromo-2-nitro-3-(2,2,2-trifluoroethoxy)benzoate (PubChem CID 157010640) has the molecular formula C10H7BrF3NO5 and a molecular weight of 358.07 g/mol. Its IUPAC name is methyl 4-bromo-2-nitro-3-(2,2,2-trifluoroethoxy)benzoate.
| Compound Name | methyl 4-bromo-2-nitro-3-(2,2,2-trifluoroethoxy)benzoate |
|---|---|
| PubChem CID | 157010640 |
| Molecular Formula | C10H7BrF3NO5 |
| Molecular Weight | 358.07 g/mol |
| Exact Mass | 356.95 |
| IUPAC Name | methyl 4-bromo-2-nitro-3-(2,2,2-trifluoroethoxy)benzoate |
| SMILES | COC(=O)c1ccc(Br)c(OCC(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H7BrF3NO5/c1-19-9(16)5-2-3-6(11)8(7(5)15(17)18)20-4-10(12,13)14/h2-3H,4H2,1H3 |
| InChIKey | BMNFBZPBIGQYMF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.07 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|