C9H7BrF3NO3 — CID 127053548
1-bromo-2-methyl-3-nitro-4-(2,2,2-trifluoroethoxy)benzene (PubChem CID 127053548) has the molecular formula C9H7BrF3NO3 and a molecular weight of 314.06 g/mol. Its IUPAC name is 1-bromo-2-methyl-3-nitro-4-(2,2,2-trifluoroethoxy)benzene.
| Compound Name | 1-bromo-2-methyl-3-nitro-4-(2,2,2-trifluoroethoxy)benzene |
|---|---|
| PubChem CID | 127053548 |
| Molecular Formula | C9H7BrF3NO3 |
| Molecular Weight | 314.06 g/mol |
| Exact Mass | 312.96 |
| IUPAC Name | 1-bromo-2-methyl-3-nitro-4-(2,2,2-trifluoroethoxy)benzene |
| SMILES | Cc1c(Br)ccc(OCC(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H7BrF3NO3/c1-5-6(10)2-3-7(8(5)14(15)16)17-4-9(11,12)13/h2-3H,4H2,1H3 |
| InChIKey | KMOAUBGCTAWGCM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.06 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|