C11H13F3N2O5 — CID 23110960
2-(2-methoxyethoxy)-6-methyl-3-nitro-4-(2,2,2-trifluoroethoxy)pyridine (PubChem CID 23110960) has the molecular formula C11H13F3N2O5 and a molecular weight of 310.23 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-6-methyl-3-nitro-4-(2,2,2-trifluoroethoxy)pyridine.
| Compound Name | 2-(2-methoxyethoxy)-6-methyl-3-nitro-4-(2,2,2-trifluoroethoxy)pyridine |
|---|---|
| PubChem CID | 23110960 |
| Molecular Formula | C11H13F3N2O5 |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-(2-methoxyethoxy)-6-methyl-3-nitro-4-(2,2,2-trifluoroethoxy)pyridine |
| SMILES | COCCOc1nc(C)cc(OCC(F)(F)F)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13F3N2O5/c1-7-5-8(21-6-11(12,13)14)9(16(17)18)10(15-7)20-4-3-19-2/h5H,3-4,6H2,1-2H3 |
| InChIKey | ILLYTBCNWLRYRP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|