4-bromo-2-(ethylamino)-3-(2,2,2-trifluoroethoxy)benzoic acid

C11H11BrF3NO3 — CID 22621017

IUPAC4-bromo-2-(ethylamino)-3-(2,2,2-trifluoroethoxy)benzoic acid
SMILESCCNc1c(C(=O)O)ccc(Br)c1OCC(F)(F)F
InChIInChI=1S/C11H11BrF3NO3/c1-2-16-8-6(10(17)18)3-4-7(12)9(8)19-5-11(13,14)15/h3-4,16H,2,5H2,1H3,(H,17,18)
InChIKeyVXKLQVSHLLGQNW-UHFFFAOYSA-N
MW342.11 g/mol
LogP3.52
Rot. Bonds5

About 4-bromo-2-(ethylamino)-3-(2,2,2-trifluoroethoxy)benzoic acid

4-bromo-2-(ethylamino)-3-(2,2,2-trifluoroethoxy)benzoic acid (PubChem CID 22621017) has the molecular formula C11H11BrF3NO3 and a molecular weight of 342.11 g/mol. Its IUPAC name is 4-bromo-2-(ethylamino)-3-(2,2,2-trifluoroethoxy)benzoic acid.

Molecular Properties

Compound Name4-bromo-2-(ethylamino)-3-(2,2,2-trifluoroethoxy)benzoic acid
PubChem CID22621017
Molecular FormulaC11H11BrF3NO3
Molecular Weight342.11 g/mol
Exact Mass340.99
IUPAC Name4-bromo-2-(ethylamino)-3-(2,2,2-trifluoroethoxy)benzoic acid
SMILESCCNc1c(C(=O)O)ccc(Br)c1OCC(F)(F)F
InChIInChI=1S/C11H11BrF3NO3/c1-2-16-8-6(10(17)18)3-4-7(12)9(8)19-5-11(13,14)15/h3-4,16H,2,5H2,1H3,(H,17,18)
InChIKeyVXKLQVSHLLGQNW-UHFFFAOYSA-N
XLogP3.52
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500342.11
LogP ≤ 53.52
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-bromo-2-(ethylamino)-3-(2,2,2-trifluoroethoxy)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-bromo-2-(ethylamino)-3-(2,2,2-trifluoroethoxy)benzoic acid?
The IUPAC name of 4-bromo-2-(ethylamino)-3-(2,2,2-trifluoroethoxy)benzoic acid (CID 22621017) is 4-bromo-2-(ethylamino)-3-(2,2,2-trifluoroethoxy)benzoic acid.
What is the SMILES notation for 4-bromo-2-(ethylamino)-3-(2,2,2-trifluoroethoxy)benzoic acid?
The canonical SMILES for 4-bromo-2-(ethylamino)-3-(2,2,2-trifluoroethoxy)benzoic acid is CCNc1c(C(=O)O)ccc(Br)c1OCC(F)(F)F.
What is the InChIKey of 4-bromo-2-(ethylamino)-3-(2,2,2-trifluoroethoxy)benzoic acid?
The InChIKey is VXKLQVSHLLGQNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrF3NO3/c1-2-16-8-6(10(17)18)3-4-7(12)9(8)19-5-11(13,14)15/h3-4,16H,2,5H2,1H3,(H,17,18).
What are the key properties of 4-bromo-2-(ethylamino)-3-(2,2,2-trifluoroethoxy)benzoic acid?
4-bromo-2-(ethylamino)-3-(2,2,2-trifluoroethoxy)benzoic acid has a molecular weight of 342.11 g/mol, XLogP of 3.52, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-(ethylamino)-3-(2,2,2-trifluoroethoxy)benzoic acid is sourced from PubChem (CID 22621017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).