C20H27F3N2O3 — CID 157011023
2-ethoxy-N-[[(1R,2S,3R,4S)-4-hydroxy-2-phenyl-6-(3,3,3-trifluoropropyl)-6-azaspiro[2.4]heptan-1-yl]methyl]acetamide (PubChem CID 157011023) has the molecular formula C20H27F3N2O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-ethoxy-N-[[(1R,2S,3R,4S)-4-hydroxy-2-phenyl-6-(3,3,3-trifluoropropyl)-6-azaspiro[2.4]heptan-1-yl]methyl]acetamide.
| Compound Name | 2-ethoxy-N-[[(1R,2S,3R,4S)-4-hydroxy-2-phenyl-6-(3,3,3-trifluoropropyl)-6-azaspiro[2.4]heptan-1-yl]methyl]acetamide |
|---|---|
| PubChem CID | 157011023 |
| Molecular Formula | C20H27F3N2O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 2-ethoxy-N-[[(1R,2S,3R,4S)-4-hydroxy-2-phenyl-6-(3,3,3-trifluoropropyl)-6-azaspiro[2.4]heptan-1-yl]methyl]acetamide |
| SMILES | CCOCC(=O)NC[C@@H]1[C@@H](c2ccccc2)[C@]12CN(CCC(F)(F)F)C[C@H]2O |
| InChI | InChI=1S/C20H27F3N2O3/c1-2-28-12-17(27)24-10-15-18(14-6-4-3-5-7-14)19(15)13-25(11-16(19)26)9-8-20(21,22)23/h3-7,15-16,18,26H,2,8-13H2,1H3,(H,24,27)/t15-,16-,18-,19-/m1/s1 |
| InChIKey | MKXKJJDHNHNOLY-PSBWJHGTSA-N |
| XLogP | 2.17 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |