C22H25N3OS — CID 157011589
4-[[4-(2-phenoxy-1-phenylethyl)piperazin-1-yl]methyl]-1,2-thiazole (PubChem CID 157011589) has the molecular formula C22H25N3OS and a molecular weight of 379.53 g/mol. Its IUPAC name is 4-[[4-(2-phenoxy-1-phenylethyl)piperazin-1-yl]methyl]-1,2-thiazole.
| Compound Name | 4-[[4-(2-phenoxy-1-phenylethyl)piperazin-1-yl]methyl]-1,2-thiazole |
|---|---|
| PubChem CID | 157011589 |
| Molecular Formula | C22H25N3OS |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 4-[[4-(2-phenoxy-1-phenylethyl)piperazin-1-yl]methyl]-1,2-thiazole |
| SMILES | c1ccc(OCC(c2ccccc2)N2CCN(Cc3cnsc3)CC2)cc1 |
| InChI | InChI=1S/C22H25N3OS/c1-3-7-20(8-4-1)22(17-26-21-9-5-2-6-10-21)25-13-11-24(12-14-25)16-19-15-23-27-18-19/h1-10,15,18,22H,11-14,16-17H2 |
| InChIKey | YIGUFZHQSWULNZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |