C31H40N4O5 — CID 157011993
(7R,10S)-22-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-18,19-dimethoxy-5,13,22-triazatricyclo[15.3.1.17,10]docosa-1(21),17,19-triene-4,12-dione (PubChem CID 157011993) has the molecular formula C31H40N4O5 and a molecular weight of 548.68 g/mol. Its IUPAC name is (7R,10S)-22-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-18,19-dimethoxy-5,13,22-triazatricyclo[15.3.1.17,10]docosa-1(21),17,19-triene-4,12-dione.
| Compound Name | (7R,10S)-22-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-18,19-dimethoxy-5,13,22-triazatricyclo[15.3.1.17,10]docosa-1(21),17,19-triene-4,12-dione |
|---|---|
| PubChem CID | 157011993 |
| Molecular Formula | C31H40N4O5 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | (7R,10S)-22-[2-(2,3-dihydroindol-1-yl)-2-oxoethyl]-18,19-dimethoxy-5,13,22-triazatricyclo[15.3.1.17,10]docosa-1(21),17,19-triene-4,12-dione |
| SMILES | COc1cc2cc(c1OC)CCCNC(=O)C[C@@H]1CC[C@H](CNC(=O)CC2)N1CC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C31H40N4O5/c1-39-27-17-21-9-12-28(36)33-19-25-11-10-24(18-29(37)32-14-5-7-23(16-21)31(27)40-2)35(25)20-30(38)34-15-13-22-6-3-4-8-26(22)34/h3-4,6,8,16-17,24-25H,5,7,9-15,18-20H2,1-2H3,(H,32,37)(H,33,36)/t24-,25+/m0/s1 |
| InChIKey | UZAFSQJYXASOQC-LOSJGSFVSA-N |
| XLogP | 2.63 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |