C32H42N4O6 — CID 157018368
(7R,10S)-22-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)acetyl]-18,19-dimethoxy-5,13,22-triazatricyclo[15.3.1.17,10]docosa-1(21),17,19-triene-4,12-dione (PubChem CID 157018368) has the molecular formula C32H42N4O6 and a molecular weight of 578.71 g/mol. Its IUPAC name is (7R,10S)-22-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)acetyl]-18,19-dimethoxy-5,13,22-triazatricyclo[15.3.1.17,10]docosa-1(21),17,19-triene-4,12-dione.
| Compound Name | (7R,10S)-22-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)acetyl]-18,19-dimethoxy-5,13,22-triazatricyclo[15.3.1.17,10]docosa-1(21),17,19-triene-4,12-dione |
|---|---|
| PubChem CID | 157018368 |
| Molecular Formula | C32H42N4O6 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | (7R,10S)-22-[2-(3,5-dihydro-2H-1,4-benzoxazepin-4-yl)acetyl]-18,19-dimethoxy-5,13,22-triazatricyclo[15.3.1.17,10]docosa-1(21),17,19-triene-4,12-dione |
| SMILES | COc1cc2cc(c1OC)CCCNC(=O)C[C@@H]1CC[C@H](CNC(=O)CC2)N1C(=O)CN1CCOc2ccccc2C1 |
| InChI | InChI=1S/C32H42N4O6/c1-40-28-17-22-9-12-29(37)34-19-26-11-10-25(18-30(38)33-13-5-7-23(16-22)32(28)41-2)36(26)31(39)21-35-14-15-42-27-8-4-3-6-24(27)20-35/h3-4,6,8,16-17,25-26H,5,7,9-15,18-21H2,1-2H3,(H,33,38)(H,34,37)/t25-,26+/m0/s1 |
| InChIKey | LVXPFJJQYQONNY-IZZNHLLZSA-N |
| XLogP | 2.46 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |