C28H33N5O6 — CID 157016045
(7R,10S)-18,19-dimethoxy-22-([1,2]oxazolo[3,4-b]pyridine-3-carbonyl)-5,13,22-triazatricyclo[15.3.1.17,10]docosa-1(21),17,19-triene-4,12-dione (PubChem CID 157016045) has the molecular formula C28H33N5O6 and a molecular weight of 535.60 g/mol. Its IUPAC name is (7R,10S)-18,19-dimethoxy-22-([1,2]oxazolo[3,4-b]pyridine-3-carbonyl)-5,13,22-triazatricyclo[15.3.1.17,10]docosa-1(21),17,19-triene-4,12-dione.
| Compound Name | (7R,10S)-18,19-dimethoxy-22-([1,2]oxazolo[3,4-b]pyridine-3-carbonyl)-5,13,22-triazatricyclo[15.3.1.17,10]docosa-1(21),17,19-triene-4,12-dione |
|---|---|
| PubChem CID | 157016045 |
| Molecular Formula | C28H33N5O6 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | (7R,10S)-18,19-dimethoxy-22-([1,2]oxazolo[3,4-b]pyridine-3-carbonyl)-5,13,22-triazatricyclo[15.3.1.17,10]docosa-1(21),17,19-triene-4,12-dione |
| SMILES | COc1cc2cc(c1OC)CCCNC(=O)C[C@@H]1CC[C@H](CNC(=O)CC2)N1C(=O)c1onc2ncccc12 |
| InChI | InChI=1S/C28H33N5O6/c1-37-22-14-17-7-10-23(34)31-16-20-9-8-19(15-24(35)29-11-3-5-18(13-17)25(22)38-2)33(20)28(36)26-21-6-4-12-30-27(21)32-39-26/h4,6,12-14,19-20H,3,5,7-11,15-16H2,1-2H3,(H,29,35)(H,31,34)/t19-,20+/m0/s1 |
| InChIKey | OAIQSVZTJWRWOB-VQTJNVASSA-N |
| XLogP | 2.41 |
| TPSA | 135.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |