C31H41F2N5O5 — CID 162628152
(1R,2S,21S)-23-[1-(difluoromethyl)-5-methylpyrazole-3-carbonyl]-12,13-dimethoxy-7,19,23-triazatetracyclo[19.3.1.111,15.02,19]hexacosa-11,13,15(26)-triene-6,18-dione (PubChem CID 162628152) has the molecular formula C31H41F2N5O5 and a molecular weight of 601.70 g/mol. Its IUPAC name is (1R,2S,21S)-23-[1-(difluoromethyl)-5-methylpyrazole-3-carbonyl]-12,13-dimethoxy-7,19,23-triazatetracyclo[19.3.1.111,15.02,19]hexacosa-11,13,15(26)-triene-6,18-dione.
| Compound Name | (1R,2S,21S)-23-[1-(difluoromethyl)-5-methylpyrazole-3-carbonyl]-12,13-dimethoxy-7,19,23-triazatetracyclo[19.3.1.111,15.02,19]hexacosa-11,13,15(26)-triene-6,18-dione |
|---|---|
| PubChem CID | 162628152 |
| Molecular Formula | C31H41F2N5O5 |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 601.31 |
| IUPAC Name | (1R,2S,21S)-23-[1-(difluoromethyl)-5-methylpyrazole-3-carbonyl]-12,13-dimethoxy-7,19,23-triazatetracyclo[19.3.1.111,15.02,19]hexacosa-11,13,15(26)-triene-6,18-dione |
| SMILES | COc1cc2cc(c1OC)CCCNC(=O)CCC[C@H]1[C@@H]3C[C@@H](CN(C(=O)c4cc(C)n(C(F)F)n4)C3)CN1C(=O)CC2 |
| InChI | InChI=1S/C31H41F2N5O5/c1-19-12-24(35-38(19)31(32)33)30(41)36-16-21-14-23(18-36)25-7-4-8-27(39)34-11-5-6-22-13-20(9-10-28(40)37(25)17-21)15-26(42-2)29(22)43-3/h12-13,15,21,23,25,31H,4-11,14,16-18H2,1-3H3,(H,34,39)/t21-,23+,25-/m0/s1 |
| InChIKey | NYWFQHKAILRWKT-PWWKTKHKSA-N |
| XLogP | 3.76 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |