C34H46N4O7S — CID 162634927
N-[4-[(1R,2S,21S)-12,13-dimethoxy-6,18-dioxo-7,19,23-triazatetracyclo[19.3.1.111,15.02,19]hexacosa-11,13,15(26)-triene-23-carbonyl]phenyl]-N-methylmethanesulfonamide (PubChem CID 162634927) has the molecular formula C34H46N4O7S and a molecular weight of 654.83 g/mol. Its IUPAC name is N-[4-[(1R,2S,21S)-12,13-dimethoxy-6,18-dioxo-7,19,23-triazatetracyclo[19.3.1.111,15.02,19]hexacosa-11,13,15(26)-triene-23-carbonyl]phenyl]-N-methylmethanesulfonamide.
| Compound Name | N-[4-[(1R,2S,21S)-12,13-dimethoxy-6,18-dioxo-7,19,23-triazatetracyclo[19.3.1.111,15.02,19]hexacosa-11,13,15(26)-triene-23-carbonyl]phenyl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 162634927 |
| Molecular Formula | C34H46N4O7S |
| Molecular Weight | 654.83 g/mol |
| Exact Mass | 654.31 |
| IUPAC Name | N-[4-[(1R,2S,21S)-12,13-dimethoxy-6,18-dioxo-7,19,23-triazatetracyclo[19.3.1.111,15.02,19]hexacosa-11,13,15(26)-triene-23-carbonyl]phenyl]-N-methylmethanesulfonamide |
| SMILES | COc1cc2cc(c1OC)CCCNC(=O)CCC[C@H]1[C@@H]3C[C@@H](CN(C(=O)c4ccc(N(C)S(C)(=O)=O)cc4)C3)CN1C(=O)CC2 |
| InChI | InChI=1S/C34H46N4O7S/c1-36(46(4,42)43)28-13-11-25(12-14-28)34(41)37-20-24-18-27(22-37)29-8-5-9-31(39)35-16-6-7-26-17-23(10-15-32(40)38(29)21-24)19-30(44-2)33(26)45-3/h11-14,17,19,24,27,29H,5-10,15-16,18,20-22H2,1-4H3,(H,35,39)/t24-,27+,29-/m0/s1 |
| InChIKey | QIHWLJZVVMOYHR-HWUUJZMBSA-N |
| XLogP | 3.25 |
| TPSA | 125.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.83 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |