C37H52N6O6 — CID 162627900
(1R,2S,21S)-23-[2-[4-(2-hydroxyethyl)piperazin-1-yl]pyridine-3-carbonyl]-12,13-dimethoxy-7,19,23-triazatetracyclo[19.3.1.111,15.02,19]hexacosa-11,13,15(26)-triene-6,18-dione (PubChem CID 162627900) has the molecular formula C37H52N6O6 and a molecular weight of 676.86 g/mol. Its IUPAC name is (1R,2S,21S)-23-[2-[4-(2-hydroxyethyl)piperazin-1-yl]pyridine-3-carbonyl]-12,13-dimethoxy-7,19,23-triazatetracyclo[19.3.1.111,15.02,19]hexacosa-11,13,15(26)-triene-6,18-dione.
| Compound Name | (1R,2S,21S)-23-[2-[4-(2-hydroxyethyl)piperazin-1-yl]pyridine-3-carbonyl]-12,13-dimethoxy-7,19,23-triazatetracyclo[19.3.1.111,15.02,19]hexacosa-11,13,15(26)-triene-6,18-dione |
|---|---|
| PubChem CID | 162627900 |
| Molecular Formula | C37H52N6O6 |
| Molecular Weight | 676.86 g/mol |
| Exact Mass | 676.39 |
| IUPAC Name | (1R,2S,21S)-23-[2-[4-(2-hydroxyethyl)piperazin-1-yl]pyridine-3-carbonyl]-12,13-dimethoxy-7,19,23-triazatetracyclo[19.3.1.111,15.02,19]hexacosa-11,13,15(26)-triene-6,18-dione |
| SMILES | COc1cc2cc(c1OC)CCCNC(=O)CCC[C@H]1[C@@H]3C[C@@H](CN(C(=O)c4cccnc4N4CCN(CCO)CC4)C3)CN1C(=O)CC2 |
| InChI | InChI=1S/C37H52N6O6/c1-48-32-22-26-10-11-34(46)43-24-27-21-29(31(43)8-3-9-33(45)38-12-4-6-28(20-26)35(32)49-2)25-42(23-27)37(47)30-7-5-13-39-36(30)41-16-14-40(15-17-41)18-19-44/h5,7,13,20,22,27,29,31,44H,3-4,6,8-12,14-19,21,23-25H2,1-2H3,(H,38,45)/t27-,29+,31-/m0/s1 |
| InChIKey | SUVJXXQMHZPPDP-DLTIGGJNSA-N |
| XLogP | 2.37 |
| TPSA | 127.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.86 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |