C20H25FN4O3 — CID 157015089
(1S,3S,4S)-3-[[2-(2-fluorophenyl)acetyl]amino]-4-hydroxy-N-(3-pyrazol-1-ylpropyl)cyclopentane-1-carboxamide (PubChem CID 157015089) has the molecular formula C20H25FN4O3 and a molecular weight of 388.44 g/mol. Its IUPAC name is (1S,3S,4S)-3-[[2-(2-fluorophenyl)acetyl]amino]-4-hydroxy-N-(3-pyrazol-1-ylpropyl)cyclopentane-1-carboxamide.
| Compound Name | (1S,3S,4S)-3-[[2-(2-fluorophenyl)acetyl]amino]-4-hydroxy-N-(3-pyrazol-1-ylpropyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 157015089 |
| Molecular Formula | C20H25FN4O3 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (1S,3S,4S)-3-[[2-(2-fluorophenyl)acetyl]amino]-4-hydroxy-N-(3-pyrazol-1-ylpropyl)cyclopentane-1-carboxamide |
| SMILES | O=C(Cc1ccccc1F)N[C@H]1C[C@H](C(=O)NCCCn2cccn2)C[C@@H]1O |
| InChI | InChI=1S/C20H25FN4O3/c21-16-6-2-1-5-14(16)13-19(27)24-17-11-15(12-18(17)26)20(28)22-7-3-9-25-10-4-8-23-25/h1-2,4-6,8,10,15,17-18,26H,3,7,9,11-13H2,(H,22,28)(H,24,27)/t15-,17-,18-/m0/s1 |
| InChIKey | UAOXSCZCAPTJTN-SZMVWBNQSA-N |
| XLogP | 1.03 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|