C21H25N3O2 — CID 157016695
N-(5,6-dimethyl-4-phenyl-2-pyridinyl)-2-(2-oxoazepan-1-yl)acetamide (PubChem CID 157016695) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-(5,6-dimethyl-4-phenyl-2-pyridinyl)-2-(2-oxoazepan-1-yl)acetamide.
| Compound Name | N-(5,6-dimethyl-4-phenyl-2-pyridinyl)-2-(2-oxoazepan-1-yl)acetamide |
|---|---|
| PubChem CID | 157016695 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | N-(5,6-dimethyl-4-phenyl-2-pyridinyl)-2-(2-oxoazepan-1-yl)acetamide |
| SMILES | Cc1nc(NC(=O)CN2CCCCCC2=O)cc(-c2ccccc2)c1C |
| InChI | InChI=1S/C21H25N3O2/c1-15-16(2)22-19(13-18(15)17-9-5-3-6-10-17)23-20(25)14-24-12-8-4-7-11-21(24)26/h3,5-6,9-10,13H,4,7-8,11-12,14H2,1-2H3,(H,22,23,25) |
| InChIKey | BCLWMJJFTRFTAK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |