C17H21N7 — CID 157019637
7-methyl-2-[4-[(3-methyl-2-pyridinyl)methyl]piperazin-1-yl]purine (PubChem CID 157019637) has the molecular formula C17H21N7 and a molecular weight of 323.40 g/mol. Its IUPAC name is 7-methyl-2-[4-[(3-methyl-2-pyridinyl)methyl]piperazin-1-yl]purine.
| Compound Name | 7-methyl-2-[4-[(3-methyl-2-pyridinyl)methyl]piperazin-1-yl]purine |
|---|---|
| PubChem CID | 157019637 |
| Molecular Formula | C17H21N7 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 7-methyl-2-[4-[(3-methyl-2-pyridinyl)methyl]piperazin-1-yl]purine |
| SMILES | Cc1cccnc1CN1CCN(c2ncc3c(ncn3C)n2)CC1 |
| InChI | InChI=1S/C17H21N7/c1-13-4-3-5-18-14(13)11-23-6-8-24(9-7-23)17-19-10-15-16(21-17)20-12-22(15)2/h3-5,10,12H,6-9,11H2,1-2H3 |
| InChIKey | KCVGELFKPFIKGW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |