C31H33NO7 — CID 157021224
1-[4-[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-1,3-oxazol-2-yl]ethane-1,2-diol (PubChem CID 157021224) has the molecular formula C31H33NO7 and a molecular weight of 531.61 g/mol. Its IUPAC name is 1-[4-[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-1,3-oxazol-2-yl]ethane-1,2-diol.
| Compound Name | 1-[4-[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-1,3-oxazol-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 157021224 |
| Molecular Formula | C31H33NO7 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | 1-[4-[(2S,3S,4R,5R)-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-yl]-1,3-oxazol-2-yl]ethane-1,2-diol |
| SMILES | OCC(O)c1nc([C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H]2OCc2ccccc2)co1 |
| InChI | InChI=1S/C31H33NO7/c33-16-26(34)31-32-25(20-38-31)28-30(37-19-24-14-8-3-9-15-24)29(36-18-23-12-6-2-7-13-23)27(39-28)21-35-17-22-10-4-1-5-11-22/h1-15,20,26-30,33-34H,16-19,21H2/t26?,27-,28+,29-,30+/m1/s1 |
| InChIKey | PEVOTYVUOHSFSE-KXCDBBNJSA-N |
| XLogP | 4.53 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |