C17H10FN3O2S — CID 157022031
3-[3-(4-fluorophenyl)-4-hydroxy-2-sulfanylidene-1H-imidazol-5-yl]indol-2-one (PubChem CID 157022031) has the molecular formula C17H10FN3O2S and a molecular weight of 339.35 g/mol. Its IUPAC name is 3-[3-(4-fluorophenyl)-4-hydroxy-2-sulfanylidene-1H-imidazol-5-yl]indol-2-one.
| Compound Name | 3-[3-(4-fluorophenyl)-4-hydroxy-2-sulfanylidene-1H-imidazol-5-yl]indol-2-one |
|---|---|
| PubChem CID | 157022031 |
| Molecular Formula | C17H10FN3O2S |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 3-[3-(4-fluorophenyl)-4-hydroxy-2-sulfanylidene-1H-imidazol-5-yl]indol-2-one |
| SMILES | O=C1N=c2ccccc2=C1c1[nH]c(=S)n(-c2ccc(F)cc2)c1O |
| InChI | InChI=1S/C17H10FN3O2S/c18-9-5-7-10(8-6-9)21-16(23)14(20-17(21)24)13-11-3-1-2-4-12(11)19-15(13)22/h1-8,23H,(H,20,24) |
| InChIKey | LRPVXUJHDBXSLZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|