C21H21FKN3O2 — CID 157024093
potassium [(E)-C-[2-[[(E)-1-(3-ethynyl-5-fluorophenyl)ethylideneamino]oxymethyl]-3-methylphenyl]-N-methoxycarbonimidoyl]-methylazanide (PubChem CID 157024093) has the molecular formula C21H21FKN3O2 and a molecular weight of 405.51 g/mol. Its IUPAC name is potassium [(E)-C-[2-[[(E)-1-(3-ethynyl-5-fluorophenyl)ethylideneamino]oxymethyl]-3-methylphenyl]-N-methoxycarbonimidoyl]-methylazanide.
| Compound Name | potassium [(E)-C-[2-[[(E)-1-(3-ethynyl-5-fluorophenyl)ethylideneamino]oxymethyl]-3-methylphenyl]-N-methoxycarbonimidoyl]-methylazanide |
|---|---|
| PubChem CID | 157024093 |
| Molecular Formula | C21H21FKN3O2 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | potassium [(E)-C-[2-[[(E)-1-(3-ethynyl-5-fluorophenyl)ethylideneamino]oxymethyl]-3-methylphenyl]-N-methoxycarbonimidoyl]-methylazanide |
| SMILES | C#Cc1cc(F)cc(/C(C)=N/OCc2c(C)cccc2/C(=N\OC)[N-]C)c1.[K+] |
| InChI | InChI=1S/C21H21FN3O2.K/c1-6-16-10-17(12-18(22)11-16)15(3)24-27-13-20-14(2)8-7-9-19(20)21(23-4)25-26-5;/h1,7-12H,13H2,2-5H3;/q-1;+1/b24-15+; |
| InChIKey | JDAZCPRGXXTXBW-CFYFISJPSA-N |
| XLogP | 1.37 |
| TPSA | 57.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|