C21H24N2O4 — CID 157024348
methyl (2E)-2-methoxyimino-2-[3-methyl-4-[[(E)-1-(4-methylphenyl)ethylideneamino]oxymethyl]phenyl]acetate (PubChem CID 157024348) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is methyl (2E)-2-methoxyimino-2-[3-methyl-4-[[(E)-1-(4-methylphenyl)ethylideneamino]oxymethyl]phenyl]acetate.
| Compound Name | methyl (2E)-2-methoxyimino-2-[3-methyl-4-[[(E)-1-(4-methylphenyl)ethylideneamino]oxymethyl]phenyl]acetate |
|---|---|
| PubChem CID | 157024348 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | methyl (2E)-2-methoxyimino-2-[3-methyl-4-[[(E)-1-(4-methylphenyl)ethylideneamino]oxymethyl]phenyl]acetate |
| SMILES | CO/N=C(/C(=O)OC)c1ccc(CO/N=C(\C)c2ccc(C)cc2)c(C)c1 |
| InChI | InChI=1S/C21H24N2O4/c1-14-6-8-17(9-7-14)16(3)22-27-13-19-11-10-18(12-15(19)2)20(23-26-5)21(24)25-4/h6-12H,13H2,1-5H3/b22-16+,23-20+ |
| InChIKey | KKNZZFJXXLQSKG-VVJAPSPLSA-N |
| XLogP | 3.77 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|