C25H21ClF3N3O2 — CID 157027804
6-[2-(3-chlorophenyl)-2,2-difluoroacetyl]-2-[1-(3-fluorophenyl)cyclopropyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one (PubChem CID 157027804) has the molecular formula C25H21ClF3N3O2 and a molecular weight of 487.91 g/mol. Its IUPAC name is 6-[2-(3-chlorophenyl)-2,2-difluoroacetyl]-2-[1-(3-fluorophenyl)cyclopropyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one.
| Compound Name | 6-[2-(3-chlorophenyl)-2,2-difluoroacetyl]-2-[1-(3-fluorophenyl)cyclopropyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one |
|---|---|
| PubChem CID | 157027804 |
| Molecular Formula | C25H21ClF3N3O2 |
| Molecular Weight | 487.91 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | 6-[2-(3-chlorophenyl)-2,2-difluoroacetyl]-2-[1-(3-fluorophenyl)cyclopropyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one |
| SMILES | O=C(N1CCCc2nc(C3(c4cccc(F)c4)CC3)[nH]c(=O)c2C1)C(F)(F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H21ClF3N3O2/c26-17-6-1-5-16(12-17)25(28,29)23(34)32-11-3-8-20-19(14-32)21(33)31-22(30-20)24(9-10-24)15-4-2-7-18(27)13-15/h1-2,4-7,12-13H,3,8-11,14H2,(H,30,31,33) |
| InChIKey | MKADARYPXAKRSO-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.91 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |