C24H20F5N3O2S — CID 157028189
6-[2,2-difluoro-2-[3-(trifluoromethyl)phenyl]acetyl]-2-(1-thiophen-2-ylcyclopropyl)-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one (PubChem CID 157028189) has the molecular formula C24H20F5N3O2S and a molecular weight of 509.50 g/mol. Its IUPAC name is 6-[2,2-difluoro-2-[3-(trifluoromethyl)phenyl]acetyl]-2-(1-thiophen-2-ylcyclopropyl)-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one.
| Compound Name | 6-[2,2-difluoro-2-[3-(trifluoromethyl)phenyl]acetyl]-2-(1-thiophen-2-ylcyclopropyl)-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one |
|---|---|
| PubChem CID | 157028189 |
| Molecular Formula | C24H20F5N3O2S |
| Molecular Weight | 509.50 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | 6-[2,2-difluoro-2-[3-(trifluoromethyl)phenyl]acetyl]-2-(1-thiophen-2-ylcyclopropyl)-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one |
| SMILES | O=C(N1CCCc2nc(C3(c4cccs4)CC3)[nH]c(=O)c2C1)C(F)(F)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H20F5N3O2S/c25-23(26,14-4-1-5-15(12-14)24(27,28)29)21(34)32-10-2-6-17-16(13-32)19(33)31-20(30-17)22(8-9-22)18-7-3-11-35-18/h1,3-5,7,11-12H,2,6,8-10,13H2,(H,30,31,33) |
| InChIKey | YFEFTFSRDSJWQT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |