C32H32F3N3O4S — CID 170307263
2-[1-[4-[2-(1-hydroxycyclohexyl)ethynyl]thiophen-2-yl]cyclopropyl]-6-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]acetyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one (PubChem CID 170307263) has the molecular formula C32H32F3N3O4S and a molecular weight of 611.69 g/mol. Its IUPAC name is 2-[1-[4-[2-(1-hydroxycyclohexyl)ethynyl]thiophen-2-yl]cyclopropyl]-6-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]acetyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one.
| Compound Name | 2-[1-[4-[2-(1-hydroxycyclohexyl)ethynyl]thiophen-2-yl]cyclopropyl]-6-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]acetyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one |
|---|---|
| PubChem CID | 170307263 |
| Molecular Formula | C32H32F3N3O4S |
| Molecular Weight | 611.69 g/mol |
| Exact Mass | 611.21 |
| IUPAC Name | 2-[1-[4-[2-(1-hydroxycyclohexyl)ethynyl]thiophen-2-yl]cyclopropyl]-6-[2-hydroxy-2-[3-(trifluoromethyl)phenyl]acetyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one |
| SMILES | O=C(C(O)c1cccc(C(F)(F)F)c1)N1CCCc2nc(C3(c4cc(C#CC5(O)CCCCC5)cs4)CC3)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C32H32F3N3O4S/c33-32(34,35)22-7-4-6-21(17-22)26(39)28(41)38-15-5-8-24-23(18-38)27(40)37-29(36-24)31(13-14-31)25-16-20(19-43-25)9-12-30(42)10-2-1-3-11-30/h4,6-7,16-17,19,26,39,42H,1-3,5,8,10-11,13-15,18H2,(H,36,37,40) |
| InChIKey | WKHZILDITCPVDI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 106.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.69 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|