C29H28F3N3O3S — CID 166815945
2-[1-[4-(cyclopenten-1-yl)thiophen-2-yl]cyclopropyl]-6-[(2R)-2-hydroxy-2-[3-(trifluoromethyl)phenyl]acetyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one (PubChem CID 166815945) has the molecular formula C29H28F3N3O3S and a molecular weight of 555.62 g/mol. Its IUPAC name is 2-[1-[4-(cyclopenten-1-yl)thiophen-2-yl]cyclopropyl]-6-[(2R)-2-hydroxy-2-[3-(trifluoromethyl)phenyl]acetyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one.
| Compound Name | 2-[1-[4-(cyclopenten-1-yl)thiophen-2-yl]cyclopropyl]-6-[(2R)-2-hydroxy-2-[3-(trifluoromethyl)phenyl]acetyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one |
|---|---|
| PubChem CID | 166815945 |
| Molecular Formula | C29H28F3N3O3S |
| Molecular Weight | 555.62 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | 2-[1-[4-(cyclopenten-1-yl)thiophen-2-yl]cyclopropyl]-6-[(2R)-2-hydroxy-2-[3-(trifluoromethyl)phenyl]acetyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one |
| SMILES | O=C([C@H](O)c1cccc(C(F)(F)F)c1)N1CCCc2nc(C3(c4cc(C5=CCCC5)cs4)CC3)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C29H28F3N3O3S/c30-29(31,32)20-8-3-7-18(13-20)24(36)26(38)35-12-4-9-22-21(15-35)25(37)34-27(33-22)28(10-11-28)23-14-19(16-39-23)17-5-1-2-6-17/h3,5,7-8,13-14,16,24,36H,1-2,4,6,9-12,15H2,(H,33,34,37)/t24-/m1/s1 |
| InChIKey | VWMOBGFGODZFDW-XMMPIXPASA-N |
| XLogP | 5.51 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.62 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |