C26H23ClN4O3S2 — CID 175367256
6-[2-(3-chlorophenyl)-2-hydroxyacetyl]-2-[1-[4-(1,2-thiazol-4-yl)thiophen-2-yl]cyclopropyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one (PubChem CID 175367256) has the molecular formula C26H23ClN4O3S2 and a molecular weight of 539.08 g/mol. Its IUPAC name is 6-[2-(3-chlorophenyl)-2-hydroxyacetyl]-2-[1-[4-(1,2-thiazol-4-yl)thiophen-2-yl]cyclopropyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one.
| Compound Name | 6-[2-(3-chlorophenyl)-2-hydroxyacetyl]-2-[1-[4-(1,2-thiazol-4-yl)thiophen-2-yl]cyclopropyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one |
|---|---|
| PubChem CID | 175367256 |
| Molecular Formula | C26H23ClN4O3S2 |
| Molecular Weight | 539.08 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | 6-[2-(3-chlorophenyl)-2-hydroxyacetyl]-2-[1-[4-(1,2-thiazol-4-yl)thiophen-2-yl]cyclopropyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one |
| SMILES | O=C(C(O)c1cccc(Cl)c1)N1CCCc2nc(C3(c4cc(-c5cnsc5)cs4)CC3)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C26H23ClN4O3S2/c27-18-4-1-3-15(9-18)22(32)24(34)31-8-2-5-20-19(12-31)23(33)30-25(29-20)26(6-7-26)21-10-16(13-35-21)17-11-28-36-14-17/h1,3-4,9-11,13-14,22,32H,2,5-8,12H2,(H,29,30,33) |
| InChIKey | DBZBHJYJBSVXAN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.08 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |