C29H28F3N3O4S — CID 166815984
2-[1-[4-(3-hydroxy-3-methylbut-1-ynyl)thiophen-2-yl]cyclopropyl]-6-[(2R)-2-hydroxy-2-[3-(trifluoromethyl)phenyl]acetyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one (PubChem CID 166815984) has the molecular formula C29H28F3N3O4S and a molecular weight of 571.62 g/mol. Its IUPAC name is 2-[1-[4-(3-hydroxy-3-methylbut-1-ynyl)thiophen-2-yl]cyclopropyl]-6-[(2R)-2-hydroxy-2-[3-(trifluoromethyl)phenyl]acetyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one.
| Compound Name | 2-[1-[4-(3-hydroxy-3-methylbut-1-ynyl)thiophen-2-yl]cyclopropyl]-6-[(2R)-2-hydroxy-2-[3-(trifluoromethyl)phenyl]acetyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one |
|---|---|
| PubChem CID | 166815984 |
| Molecular Formula | C29H28F3N3O4S |
| Molecular Weight | 571.62 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 2-[1-[4-(3-hydroxy-3-methylbut-1-ynyl)thiophen-2-yl]cyclopropyl]-6-[(2R)-2-hydroxy-2-[3-(trifluoromethyl)phenyl]acetyl]-5,7,8,9-tetrahydro-3H-pyrimido[5,4-c]azepin-4-one |
| SMILES | CC(C)(O)C#Cc1csc(C2(c3nc4c(c(=O)[nH]3)CN(C(=O)[C@H](O)c3cccc(C(F)(F)F)c3)CCC4)CC2)c1 |
| InChI | InChI=1S/C29H28F3N3O4S/c1-27(2,39)9-8-17-13-22(40-16-17)28(10-11-28)26-33-21-7-4-12-35(15-20(21)24(37)34-26)25(38)23(36)18-5-3-6-19(14-18)29(30,31)32/h3,5-6,13-14,16,23,36,39H,4,7,10-12,15H2,1-2H3,(H,33,34,37)/t23-/m1/s1 |
| InChIKey | GKFMZOTVIONMAJ-HSZRJFAPSA-N |
| XLogP | 4.06 |
| TPSA | 106.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.62 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|