C25H19ClF5N3O2 — CID 157027386
2-[1-(3-chlorophenyl)cyclopropyl]-6-[2,2-difluoro-2-[3-(trifluoromethyl)phenyl]acetyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 157027386) has the molecular formula C25H19ClF5N3O2 and a molecular weight of 523.89 g/mol. Its IUPAC name is 2-[1-(3-chlorophenyl)cyclopropyl]-6-[2,2-difluoro-2-[3-(trifluoromethyl)phenyl]acetyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-[1-(3-chlorophenyl)cyclopropyl]-6-[2,2-difluoro-2-[3-(trifluoromethyl)phenyl]acetyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 157027386 |
| Molecular Formula | C25H19ClF5N3O2 |
| Molecular Weight | 523.89 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | 2-[1-(3-chlorophenyl)cyclopropyl]-6-[2,2-difluoro-2-[3-(trifluoromethyl)phenyl]acetyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=C(N1CCc2nc(C3(c4cccc(Cl)c4)CC3)[nH]c(=O)c2C1)C(F)(F)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H19ClF5N3O2/c26-17-6-2-3-14(12-17)23(8-9-23)21-32-19-7-10-34(13-18(19)20(35)33-21)22(36)24(27,28)15-4-1-5-16(11-15)25(29,30)31/h1-6,11-12H,7-10,13H2,(H,32,33,35) |
| InChIKey | QUABCXVADDIVRG-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.89 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |