C15H9ClF3N3 — CID 157032424
6-chloro-8-[(1S,2S)-2-(2,3,5-trifluorophenyl)cyclopropyl]imidazo[1,2-b]pyridazine (PubChem CID 157032424) has the molecular formula C15H9ClF3N3 and a molecular weight of 323.71 g/mol. Its IUPAC name is 6-chloro-8-[(1S,2S)-2-(2,3,5-trifluorophenyl)cyclopropyl]imidazo[1,2-b]pyridazine.
| Compound Name | 6-chloro-8-[(1S,2S)-2-(2,3,5-trifluorophenyl)cyclopropyl]imidazo[1,2-b]pyridazine |
|---|---|
| PubChem CID | 157032424 |
| Molecular Formula | C15H9ClF3N3 |
| Molecular Weight | 323.71 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 6-chloro-8-[(1S,2S)-2-(2,3,5-trifluorophenyl)cyclopropyl]imidazo[1,2-b]pyridazine |
| SMILES | Fc1cc(F)c(F)c([C@H]2C[C@@H]2c2cc(Cl)nn3ccnc23)c1 |
| InChI | InChI=1S/C15H9ClF3N3/c16-13-6-11(15-20-1-2-22(15)21-13)9-5-8(9)10-3-7(17)4-12(18)14(10)19/h1-4,6,8-9H,5H2/t8-,9-/m0/s1 |
| InChIKey | PRXAEONJUQDGRR-IUCAKERBSA-N |
| XLogP | 4.07 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.71 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|