C21H15ClF4N4O — CID 175843040
5'-[(1S,2S)-2-(6-chloroimidazo[1,2-b]pyridazin-8-yl)cyclopropyl]-4'-fluoro-1'-(2,2,2-trifluoroethyl)spiro[cyclopropane-1,3'-indole]-2'-one (PubChem CID 175843040) has the molecular formula C21H15ClF4N4O and a molecular weight of 450.82 g/mol. Its IUPAC name is 5'-[(1S,2S)-2-(6-chloroimidazo[1,2-b]pyridazin-8-yl)cyclopropyl]-4'-fluoro-1'-(2,2,2-trifluoroethyl)spiro[cyclopropane-1,3'-indole]-2'-one.
| Compound Name | 5'-[(1S,2S)-2-(6-chloroimidazo[1,2-b]pyridazin-8-yl)cyclopropyl]-4'-fluoro-1'-(2,2,2-trifluoroethyl)spiro[cyclopropane-1,3'-indole]-2'-one |
|---|---|
| PubChem CID | 175843040 |
| Molecular Formula | C21H15ClF4N4O |
| Molecular Weight | 450.82 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 5'-[(1S,2S)-2-(6-chloroimidazo[1,2-b]pyridazin-8-yl)cyclopropyl]-4'-fluoro-1'-(2,2,2-trifluoroethyl)spiro[cyclopropane-1,3'-indole]-2'-one |
| SMILES | O=C1N(CC(F)(F)F)c2ccc([C@H]3C[C@@H]3c3cc(Cl)nn4ccnc34)c(F)c2C12CC2 |
| InChI | InChI=1S/C21H15ClF4N4O/c22-15-8-13(18-27-5-6-30(18)28-15)12-7-11(12)10-1-2-14-16(17(10)23)20(3-4-20)19(31)29(14)9-21(24,25)26/h1-2,5-6,8,11-12H,3-4,7,9H2/t11-,12+/m1/s1 |
| InChIKey | UDELTOKNYKHKDJ-NEPJUHHUSA-N |
| XLogP | 4.73 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.82 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |